C12H18N4O4 — CID 128787231
2-(1-hydroxyethyl)-N-(2-methoxypyrimidin-4-yl)morpholine-4-carboxamide (PubChem CID 128787231) has the molecular formula C12H18N4O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-(1-hydroxyethyl)-N-(2-methoxypyrimidin-4-yl)morpholine-4-carboxamide.
| Compound Name | 2-(1-hydroxyethyl)-N-(2-methoxypyrimidin-4-yl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 128787231 |
| Molecular Formula | C12H18N4O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 2-(1-hydroxyethyl)-N-(2-methoxypyrimidin-4-yl)morpholine-4-carboxamide |
| SMILES | COc1nccc(NC(=O)N2CCOC(C(C)O)C2)n1 |
| InChI | InChI=1S/C12H18N4O4/c1-8(17)9-7-16(5-6-20-9)12(18)15-10-3-4-13-11(14-10)19-2/h3-4,8-9,17H,5-7H2,1-2H3,(H,13,14,15,18) |
| InChIKey | YYHOFYYTMQIDGR-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |