About tert-butyl (6R,7R)-7-azido-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate
tert-butyl (6R,7R)-7-azido-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 12878902) has the molecular formula C12H15ClN4O3
and a molecular weight of 298.73 g/mol. Its IUPAC name is tert-butyl (6R,7R)-7-azido-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (6R,7R)-7-azido-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| PubChem CID | 12878902 |
| Molecular Formula | C12H15ClN4O3 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | tert-butyl (6R,7R)-7-azido-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1=C(Cl)CC[C@@H]2[C@@H](N=[N+]=[N-])C(=O)N12 |
| InChI | InChI=1S/C12H15ClN4O3/c1-12(2,3)20-11(19)9-6(13)4-5-7-8(15-16-14)10(18)17(7)9/h7-8H,4-5H2,1-3H3/t7-,8-/m1/s1 |
| InChIKey | LZGFEINYTIOCOA-HTQZYQBOSA-N |
| XLogP | 2.46 |
| TPSA | 95.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (6R,7R)-7-azido-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (6R,7R)-7-azido-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate?
The IUPAC name of tert-butyl (6R,7R)-7-azido-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (CID 12878902) is tert-butyl (6R,7R)-7-azido-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
What is the SMILES notation for tert-butyl (6R,7R)-7-azido-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate?
The canonical SMILES for tert-butyl (6R,7R)-7-azido-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate is CC(C)(C)OC(=O)C1=C(Cl)CC[C@@H]2[C@@H](N=[N+]=[N-])C(=O)N12.
What is the InChIKey of tert-butyl (6R,7R)-7-azido-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate?
The InChIKey is LZGFEINYTIOCOA-HTQZYQBOSA-N. The full InChI is InChI=1S/C12H15ClN4O3/c1-12(2,3)20-11(19)9-6(13)4-5-7-8(15-16-14)10(18)17(7)9/h7-8H,4-5H2,1-3H3/t7-,8-/m1/s1.
What are the key properties of tert-butyl (6R,7R)-7-azido-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate?
tert-butyl (6R,7R)-7-azido-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate has a molecular weight of 298.73 g/mol, XLogP of 2.46, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (6R,7R)-7-azido-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate is sourced from PubChem (CID 12878902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).