About ethyl 4-oxo-2-phenyl-3,5-dihydro-2H-1,5-benzothiazepine-3-carboxylate
ethyl 4-oxo-2-phenyl-3,5-dihydro-2H-1,5-benzothiazepine-3-carboxylate (PubChem CID 12878947) has the molecular formula C18H17NO3S
and a molecular weight of 327.41 g/mol. Its IUPAC name is ethyl 4-oxo-2-phenyl-3,5-dihydro-2H-1,5-benzothiazepine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-oxo-2-phenyl-3,5-dihydro-2H-1,5-benzothiazepine-3-carboxylate |
| PubChem CID | 12878947 |
| Molecular Formula | C18H17NO3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | ethyl 4-oxo-2-phenyl-3,5-dihydro-2H-1,5-benzothiazepine-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)Nc2ccccc2SC1c1ccccc1 |
| InChI | InChI=1S/C18H17NO3S/c1-2-22-18(21)15-16(12-8-4-3-5-9-12)23-14-11-7-6-10-13(14)19-17(15)20/h3-11,15-16H,2H2,1H3,(H,19,20) |
| InChIKey | MCGKNEPUFWEVEN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-oxo-2-phenyl-3,5-dihydro-2H-1,5-benzothiazepine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-oxo-2-phenyl-3,5-dihydro-2H-1,5-benzothiazepine-3-carboxylate?
The IUPAC name of ethyl 4-oxo-2-phenyl-3,5-dihydro-2H-1,5-benzothiazepine-3-carboxylate (CID 12878947) is ethyl 4-oxo-2-phenyl-3,5-dihydro-2H-1,5-benzothiazepine-3-carboxylate.
What is the SMILES notation for ethyl 4-oxo-2-phenyl-3,5-dihydro-2H-1,5-benzothiazepine-3-carboxylate?
The canonical SMILES for ethyl 4-oxo-2-phenyl-3,5-dihydro-2H-1,5-benzothiazepine-3-carboxylate is CCOC(=O)C1C(=O)Nc2ccccc2SC1c1ccccc1.
What is the InChIKey of ethyl 4-oxo-2-phenyl-3,5-dihydro-2H-1,5-benzothiazepine-3-carboxylate?
The InChIKey is MCGKNEPUFWEVEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO3S/c1-2-22-18(21)15-16(12-8-4-3-5-9-12)23-14-11-7-6-10-13(14)19-17(15)20/h3-11,15-16H,2H2,1H3,(H,19,20).
What are the key properties of ethyl 4-oxo-2-phenyl-3,5-dihydro-2H-1,5-benzothiazepine-3-carboxylate?
ethyl 4-oxo-2-phenyl-3,5-dihydro-2H-1,5-benzothiazepine-3-carboxylate has a molecular weight of 327.41 g/mol, XLogP of 3.65, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-oxo-2-phenyl-3,5-dihydro-2H-1,5-benzothiazepine-3-carboxylate is sourced from PubChem (CID 12878947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).