C15H21N3O2 — CID 128790662
N-(1-ethyl-2-oxo-3-pyridinyl)-4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 128790662) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is N-(1-ethyl-2-oxo-3-pyridinyl)-4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | N-(1-ethyl-2-oxo-3-pyridinyl)-4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 128790662 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | N-(1-ethyl-2-oxo-3-pyridinyl)-4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | CCn1cccc(NC(=O)N2CCC(C)=C(C)C2)c1=O |
| InChI | InChI=1S/C15H21N3O2/c1-4-17-8-5-6-13(14(17)19)16-15(20)18-9-7-11(2)12(3)10-18/h5-6,8H,4,7,9-10H2,1-3H3,(H,16,20) |
| InChIKey | ROSZZRWLOWSQKV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|