About trans-(1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonyl chloride
trans-(1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonyl chloride (PubChem CID 12879987) has the molecular formula C10H15ClO
and a molecular weight of 186.68 g/mol. Its IUPAC name is trans-(1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonyl chloride.
Molecular Properties
| Compound Name | trans-(1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonyl chloride |
| PubChem CID | 12879987 |
| Molecular Formula | C10H15ClO |
| Molecular Weight | 186.68 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | trans-(1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonyl chloride |
| SMILES | CC(C)=C[C@H]1[C@@H](C(=O)Cl)C1(C)C |
| InChI | InChI=1S/C10H15ClO/c1-6(2)5-7-8(9(11)12)10(7,3)4/h5,7-8H,1-4H3/t7-,8-/m0/s1 |
| InChIKey | VNTCVNLNEOVBEE-YUMQZZPRSA-N |
| XLogP | 2.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.68 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trans-(1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonyl chloride?
The IUPAC name of trans-(1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonyl chloride (CID 12879987) is trans-(1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonyl chloride.
What is the SMILES notation for trans-(1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonyl chloride?
The canonical SMILES for trans-(1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonyl chloride is CC(C)=C[C@H]1[C@@H](C(=O)Cl)C1(C)C.
What is the InChIKey of trans-(1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonyl chloride?
The InChIKey is VNTCVNLNEOVBEE-YUMQZZPRSA-N. The full InChI is InChI=1S/C10H15ClO/c1-6(2)5-7-8(9(11)12)10(7,3)4/h5,7-8H,1-4H3/t7-,8-/m0/s1.
What are the key properties of trans-(1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonyl chloride?
trans-(1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonyl chloride has a molecular weight of 186.68 g/mol, XLogP of 2.99, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonyl chloride is sourced from PubChem (CID 12879987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).