About ethyl 2,3-dibenzyl-8-ethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate;hydrochloride
ethyl 2,3-dibenzyl-8-ethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate;hydrochloride (PubChem CID 12880746) has the molecular formula C26H32ClNO2
and a molecular weight of 426.00 g/mol. Its IUPAC name is ethyl 2,3-dibenzyl-8-ethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 2,3-dibenzyl-8-ethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate;hydrochloride |
| PubChem CID | 12880746 |
| Molecular Formula | C26H32ClNO2 |
| Molecular Weight | 426.00 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | ethyl 2,3-dibenzyl-8-ethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate;hydrochloride |
| SMILES | CCOC(=O)C1CC2C(CC)=CC1N(Cc1ccccc1)C2Cc1ccccc1.Cl |
| InChI | InChI=1S/C26H31NO2.ClH/c1-3-21-16-25-23(26(28)29-4-2)17-22(21)24(15-19-11-7-5-8-12-19)27(25)18-20-13-9-6-10-14-20;/h5-14,16,22-25H,3-4,15,17-18H2,1-2H3;1H |
| InChIKey | GDVRXFNBONVHAE-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.00 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2,3-dibenzyl-8-ethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2,3-dibenzyl-8-ethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate;hydrochloride?
The IUPAC name of ethyl 2,3-dibenzyl-8-ethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate;hydrochloride (CID 12880746) is ethyl 2,3-dibenzyl-8-ethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate;hydrochloride.
What is the SMILES notation for ethyl 2,3-dibenzyl-8-ethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate;hydrochloride?
The canonical SMILES for ethyl 2,3-dibenzyl-8-ethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate;hydrochloride is CCOC(=O)C1CC2C(CC)=CC1N(Cc1ccccc1)C2Cc1ccccc1.Cl.
What is the InChIKey of ethyl 2,3-dibenzyl-8-ethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate;hydrochloride?
The InChIKey is GDVRXFNBONVHAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H31NO2.ClH/c1-3-21-16-25-23(26(28)29-4-2)17-22(21)24(15-19-11-7-5-8-12-19)27(25)18-20-13-9-6-10-14-20;/h5-14,16,22-25H,3-4,15,17-18H2,1-2H3;1H.
What are the key properties of ethyl 2,3-dibenzyl-8-ethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate;hydrochloride?
ethyl 2,3-dibenzyl-8-ethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate;hydrochloride has a molecular weight of 426.00 g/mol, XLogP of 5.44, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,3-dibenzyl-8-ethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate;hydrochloride is sourced from PubChem (CID 12880746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).