About ethyl 2,3-dibenzyl-4,8-dimethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate
ethyl 2,3-dibenzyl-4,8-dimethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate (PubChem CID 12880775) has the molecular formula C26H31NO2
and a molecular weight of 389.54 g/mol. Its IUPAC name is ethyl 2,3-dibenzyl-4,8-dimethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate.
Molecular Properties
| Compound Name | ethyl 2,3-dibenzyl-4,8-dimethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate |
| PubChem CID | 12880775 |
| Molecular Formula | C26H31NO2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | ethyl 2,3-dibenzyl-4,8-dimethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate |
| SMILES | CCOC(=O)C1CC2(C)C(C)=CC1N(Cc1ccccc1)C2Cc1ccccc1 |
| InChI | InChI=1S/C26H31NO2/c1-4-29-25(28)22-17-26(3)19(2)15-23(22)27(18-21-13-9-6-10-14-21)24(26)16-20-11-7-5-8-12-20/h5-15,22-24H,4,16-18H2,1-3H3 |
| InChIKey | AZNXGAXQQJQHSH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2,3-dibenzyl-4,8-dimethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2,3-dibenzyl-4,8-dimethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate?
The IUPAC name of ethyl 2,3-dibenzyl-4,8-dimethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate (CID 12880775) is ethyl 2,3-dibenzyl-4,8-dimethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate.
What is the SMILES notation for ethyl 2,3-dibenzyl-4,8-dimethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate?
The canonical SMILES for ethyl 2,3-dibenzyl-4,8-dimethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate is CCOC(=O)C1CC2(C)C(C)=CC1N(Cc1ccccc1)C2Cc1ccccc1.
What is the InChIKey of ethyl 2,3-dibenzyl-4,8-dimethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate?
The InChIKey is AZNXGAXQQJQHSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H31NO2/c1-4-29-25(28)22-17-26(3)19(2)15-23(22)27(18-21-13-9-6-10-14-21)24(26)16-20-11-7-5-8-12-20/h5-15,22-24H,4,16-18H2,1-3H3.
What are the key properties of ethyl 2,3-dibenzyl-4,8-dimethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate?
ethyl 2,3-dibenzyl-4,8-dimethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate has a molecular weight of 389.54 g/mol, XLogP of 5.02, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,3-dibenzyl-4,8-dimethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate is sourced from PubChem (CID 12880775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).