C9H17N7O2S3 — CID 12881449
3-[[2-[(N'-methylcarbamimidoyl)amino]-1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide (PubChem CID 12881449) has the molecular formula C9H17N7O2S3 and a molecular weight of 351.48 g/mol. Its IUPAC name is 3-[[2-[(N'-methylcarbamimidoyl)amino]-1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide.
| Compound Name | 3-[[2-[(N'-methylcarbamimidoyl)amino]-1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide |
|---|---|
| PubChem CID | 12881449 |
| Molecular Formula | C9H17N7O2S3 |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 3-[[2-[(N'-methylcarbamimidoyl)amino]-1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide |
| SMILES | C/N=C(\N)Nc1nc(CSCC/C(N)=N/S(N)(=O)=O)cs1 |
| InChI | InChI=1S/C9H17N7O2S3/c1-13-8(11)15-9-14-6(5-20-9)4-19-3-2-7(10)16-21(12,17)18/h5H,2-4H2,1H3,(H2,10,16)(H2,12,17,18)(H3,11,13,14,15) |
| InChIKey | GKYOBWLEENILLB-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|