C15H13N3O4S — CID 12881517
N-[5-(furan-3-yl)-1,3,4-thiadiazol-2-yl]-2,6-dimethoxybenzamide (PubChem CID 12881517) has the molecular formula C15H13N3O4S and a molecular weight of 331.35 g/mol. Its IUPAC name is N-[5-(furan-3-yl)-1,3,4-thiadiazol-2-yl]-2,6-dimethoxybenzamide.
| Compound Name | N-[5-(furan-3-yl)-1,3,4-thiadiazol-2-yl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 12881517 |
| Molecular Formula | C15H13N3O4S |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-[5-(furan-3-yl)-1,3,4-thiadiazol-2-yl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1nnc(-c2ccoc2)s1 |
| InChI | InChI=1S/C15H13N3O4S/c1-20-10-4-3-5-11(21-2)12(10)13(19)16-15-18-17-14(23-15)9-6-7-22-8-9/h3-8H,1-2H3,(H,16,18,19) |
| InChIKey | ICFAAPMKVFCZIY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |