C17H18BrNO3 — CID 12881618
2-(4-bromo-3-propan-2-yloxyphenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione (PubChem CID 12881618) has the molecular formula C17H18BrNO3 and a molecular weight of 364.24 g/mol. Its IUPAC name is 2-(4-bromo-3-propan-2-yloxyphenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-(4-bromo-3-propan-2-yloxyphenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 12881618 |
| Molecular Formula | C17H18BrNO3 |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 2-(4-bromo-3-propan-2-yloxyphenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione |
| SMILES | CC(C)Oc1cc(N2C(=O)C3=C(CCCC3)C2=O)ccc1Br |
| InChI | InChI=1S/C17H18BrNO3/c1-10(2)22-15-9-11(7-8-14(15)18)19-16(20)12-5-3-4-6-13(12)17(19)21/h7-10H,3-6H2,1-2H3 |
| InChIKey | SEWDWVGOVVJYIY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|