C15H17N3O — CID 12881694
(Z)-4,4-dimethyl-1-phenyl-2-(1,2,4-triazol-1-yl)pent-1-en-3-one (PubChem CID 12881694) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is (Z)-4,4-dimethyl-1-phenyl-2-(1,2,4-triazol-1-yl)pent-1-en-3-one.
| Compound Name | (Z)-4,4-dimethyl-1-phenyl-2-(1,2,4-triazol-1-yl)pent-1-en-3-one |
|---|---|
| PubChem CID | 12881694 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | (Z)-4,4-dimethyl-1-phenyl-2-(1,2,4-triazol-1-yl)pent-1-en-3-one |
| SMILES | CC(C)(C)C(=O)/C(=C/c1ccccc1)n1cncn1 |
| InChI | InChI=1S/C15H17N3O/c1-15(2,3)14(19)13(18-11-16-10-17-18)9-12-7-5-4-6-8-12/h4-11H,1-3H3/b13-9- |
| InChIKey | QIYHEADMPPZNJY-LCYFTJDESA-N |
| XLogP | 2.89 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|