C15H21ClN2O5S — CID 12881778
N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]pyridine-4-carboxamide (PubChem CID 12881778) has the molecular formula C15H21ClN2O5S and a molecular weight of 376.86 g/mol. Its IUPAC name is N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]pyridine-4-carboxamide.
| Compound Name | N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 12881778 |
| Molecular Formula | C15H21ClN2O5S |
| Molecular Weight | 376.86 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]pyridine-4-carboxamide |
| SMILES | CSC1OC(C(NC(=O)c2ccncc2)C(C)Cl)C(O)C(O)C1O |
| InChI | InChI=1S/C15H21ClN2O5S/c1-7(16)9(18-14(22)8-3-5-17-6-4-8)13-11(20)10(19)12(21)15(23-13)24-2/h3-7,9-13,15,19-21H,1-2H3,(H,18,22) |
| InChIKey | GMWCMLPCWOPNBY-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.86 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|