C11H16O — CID 12882531
(4aR,8aS)-4-methyl-1,2,4a,7,8,8a-hexahydronaphthalen-1-ol (PubChem CID 12882531) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is (4aR,8aS)-4-methyl-1,2,4a,7,8,8a-hexahydronaphthalen-1-ol.
| Compound Name | (4aR,8aS)-4-methyl-1,2,4a,7,8,8a-hexahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 12882531 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (4aR,8aS)-4-methyl-1,2,4a,7,8,8a-hexahydronaphthalen-1-ol |
| SMILES | CC1=CCC(O)[C@H]2CCC=C[C@@H]12 |
| InChI | InChI=1S/C11H16O/c1-8-6-7-11(12)10-5-3-2-4-9(8)10/h2,4,6,9-12H,3,5,7H2,1H3/t9-,10-,11?/m0/s1 |
| InChIKey | GEHYGGMRRZXVJH-QRHSGQBVSA-N |
| XLogP | 2.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|