About 2-[4-(dimethylamino)phenyl]cyclopropane-1,1-dicarbonitrile
2-[4-(dimethylamino)phenyl]cyclopropane-1,1-dicarbonitrile (PubChem CID 12882912) has the molecular formula C13H13N3
and a molecular weight of 211.27 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]cyclopropane-1,1-dicarbonitrile.
Molecular Properties
| Compound Name | 2-[4-(dimethylamino)phenyl]cyclopropane-1,1-dicarbonitrile |
| PubChem CID | 12882912 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]cyclopropane-1,1-dicarbonitrile |
| SMILES | CN(C)c1ccc(C2CC2(C#N)C#N)cc1 |
| InChI | InChI=1S/C13H13N3/c1-16(2)11-5-3-10(4-6-11)12-7-13(12,8-14)9-15/h3-6,12H,7H2,1-2H3 |
| InChIKey | GYGASHLFQLIZRD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(dimethylamino)phenyl]cyclopropane-1,1-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(dimethylamino)phenyl]cyclopropane-1,1-dicarbonitrile?
The IUPAC name of 2-[4-(dimethylamino)phenyl]cyclopropane-1,1-dicarbonitrile (CID 12882912) is 2-[4-(dimethylamino)phenyl]cyclopropane-1,1-dicarbonitrile.
What is the SMILES notation for 2-[4-(dimethylamino)phenyl]cyclopropane-1,1-dicarbonitrile?
The canonical SMILES for 2-[4-(dimethylamino)phenyl]cyclopropane-1,1-dicarbonitrile is CN(C)c1ccc(C2CC2(C#N)C#N)cc1.
What is the InChIKey of 2-[4-(dimethylamino)phenyl]cyclopropane-1,1-dicarbonitrile?
The InChIKey is GYGASHLFQLIZRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3/c1-16(2)11-5-3-10(4-6-11)12-7-13(12,8-14)9-15/h3-6,12H,7H2,1-2H3.
What are the key properties of 2-[4-(dimethylamino)phenyl]cyclopropane-1,1-dicarbonitrile?
2-[4-(dimethylamino)phenyl]cyclopropane-1,1-dicarbonitrile has a molecular weight of 211.27 g/mol, XLogP of 2.27, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(dimethylamino)phenyl]cyclopropane-1,1-dicarbonitrile is sourced from PubChem (CID 12882912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).