C22H22BrN5O2 — CID 1288345
7-[(3-bromophenyl)methyl]-1,3-dimethyl-8-(2-phenylethylamino)purine-2,6-dione (PubChem CID 1288345) has the molecular formula C22H22BrN5O2 and a molecular weight of 468.36 g/mol. Its IUPAC name is 7-[(3-bromophenyl)methyl]-1,3-dimethyl-8-(2-phenylethylamino)purine-2,6-dione.
| Compound Name | 7-[(3-bromophenyl)methyl]-1,3-dimethyl-8-(2-phenylethylamino)purine-2,6-dione |
|---|---|
| PubChem CID | 1288345 |
| Molecular Formula | C22H22BrN5O2 |
| Molecular Weight | 468.36 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | 7-[(3-bromophenyl)methyl]-1,3-dimethyl-8-(2-phenylethylamino)purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(NCCc3ccccc3)n2Cc2cccc(Br)c2)n(C)c1=O |
| InChI | InChI=1S/C22H22BrN5O2/c1-26-19-18(20(29)27(2)22(26)30)28(14-16-9-6-10-17(23)13-16)21(25-19)24-12-11-15-7-4-3-5-8-15/h3-10,13H,11-12,14H2,1-2H3,(H,24,25) |
| InChIKey | GCABVBUOAZXUSJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |