About methyl 1-[N-(2,3-dimethylphenyl)-C-phenylcarbonimidoyl]-5-methylpyrazole-3-carboxylate
methyl 1-[N-(2,3-dimethylphenyl)-C-phenylcarbonimidoyl]-5-methylpyrazole-3-carboxylate (PubChem CID 12883491) has the molecular formula C21H21N3O2
and a molecular weight of 347.42 g/mol. Its IUPAC name is methyl 1-[N-(2,3-dimethylphenyl)-C-phenylcarbonimidoyl]-5-methylpyrazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[N-(2,3-dimethylphenyl)-C-phenylcarbonimidoyl]-5-methylpyrazole-3-carboxylate |
| PubChem CID | 12883491 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | methyl 1-[N-(2,3-dimethylphenyl)-C-phenylcarbonimidoyl]-5-methylpyrazole-3-carboxylate |
| SMILES | COC(=O)c1cc(C)n(/C(=N/c2cccc(C)c2C)c2ccccc2)n1 |
| InChI | InChI=1S/C21H21N3O2/c1-14-9-8-12-18(16(14)3)22-20(17-10-6-5-7-11-17)24-15(2)13-19(23-24)21(25)26-4/h5-13H,1-4H3/b22-20+ |
| InChIKey | CQRMLSVUXYGKDI-LSDHQDQOSA-N |
| XLogP | 4.22 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-[N-(2,3-dimethylphenyl)-C-phenylcarbonimidoyl]-5-methylpyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[N-(2,3-dimethylphenyl)-C-phenylcarbonimidoyl]-5-methylpyrazole-3-carboxylate?
The IUPAC name of methyl 1-[N-(2,3-dimethylphenyl)-C-phenylcarbonimidoyl]-5-methylpyrazole-3-carboxylate (CID 12883491) is methyl 1-[N-(2,3-dimethylphenyl)-C-phenylcarbonimidoyl]-5-methylpyrazole-3-carboxylate.
What is the SMILES notation for methyl 1-[N-(2,3-dimethylphenyl)-C-phenylcarbonimidoyl]-5-methylpyrazole-3-carboxylate?
The canonical SMILES for methyl 1-[N-(2,3-dimethylphenyl)-C-phenylcarbonimidoyl]-5-methylpyrazole-3-carboxylate is COC(=O)c1cc(C)n(/C(=N/c2cccc(C)c2C)c2ccccc2)n1.
What is the InChIKey of methyl 1-[N-(2,3-dimethylphenyl)-C-phenylcarbonimidoyl]-5-methylpyrazole-3-carboxylate?
The InChIKey is CQRMLSVUXYGKDI-LSDHQDQOSA-N. The full InChI is InChI=1S/C21H21N3O2/c1-14-9-8-12-18(16(14)3)22-20(17-10-6-5-7-11-17)24-15(2)13-19(23-24)21(25)26-4/h5-13H,1-4H3/b22-20+.
What are the key properties of methyl 1-[N-(2,3-dimethylphenyl)-C-phenylcarbonimidoyl]-5-methylpyrazole-3-carboxylate?
methyl 1-[N-(2,3-dimethylphenyl)-C-phenylcarbonimidoyl]-5-methylpyrazole-3-carboxylate has a molecular weight of 347.42 g/mol, XLogP of 4.22, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[N-(2,3-dimethylphenyl)-C-phenylcarbonimidoyl]-5-methylpyrazole-3-carboxylate is sourced from PubChem (CID 12883491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).