C16H16ClNO4 — CID 128837210
6-[(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-6-azaspiro[3.4]octane-5,7-dione (PubChem CID 128837210) has the molecular formula C16H16ClNO4 and a molecular weight of 321.76 g/mol. Its IUPAC name is 6-[(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-6-azaspiro[3.4]octane-5,7-dione.
| Compound Name | 6-[(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-6-azaspiro[3.4]octane-5,7-dione |
|---|---|
| PubChem CID | 128837210 |
| Molecular Formula | C16H16ClNO4 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 6-[(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-6-azaspiro[3.4]octane-5,7-dione |
| SMILES | O=C1CC2(CCC2)C(=O)N1Cc1cc2c(cc1Cl)OCCO2 |
| InChI | InChI=1S/C16H16ClNO4/c17-11-7-13-12(21-4-5-22-13)6-10(11)9-18-14(19)8-16(15(18)20)2-1-3-16/h6-7H,1-5,8-9H2 |
| InChIKey | OTGQWDCMMMRNCY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|