C13H21N5O2 — CID 128840997
3-[(3-tert-butyl-1H-1,2,4-triazol-5-yl)methyl]-1-propan-2-ylimidazolidine-2,4-dione (PubChem CID 128840997) has the molecular formula C13H21N5O2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-[(3-tert-butyl-1H-1,2,4-triazol-5-yl)methyl]-1-propan-2-ylimidazolidine-2,4-dione.
| Compound Name | 3-[(3-tert-butyl-1H-1,2,4-triazol-5-yl)methyl]-1-propan-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 128840997 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 3-[(3-tert-butyl-1H-1,2,4-triazol-5-yl)methyl]-1-propan-2-ylimidazolidine-2,4-dione |
| SMILES | CC(C)N1CC(=O)N(Cc2nc(C(C)(C)C)n[nH]2)C1=O |
| InChI | InChI=1S/C13H21N5O2/c1-8(2)17-7-10(19)18(12(17)20)6-9-14-11(16-15-9)13(3,4)5/h8H,6-7H2,1-5H3,(H,14,15,16) |
| InChIKey | VMVPDYLABIDPNI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|