C19H28N4O5S — CID 12884408
N-[2-[4-(butylcarbamoylsulfamoyl)phenyl]ethyl]-2-oxopiperidine-1-carboxamide (PubChem CID 12884408) has the molecular formula C19H28N4O5S and a molecular weight of 424.52 g/mol. Its IUPAC name is N-[2-[4-(butylcarbamoylsulfamoyl)phenyl]ethyl]-2-oxopiperidine-1-carboxamide.
| Compound Name | N-[2-[4-(butylcarbamoylsulfamoyl)phenyl]ethyl]-2-oxopiperidine-1-carboxamide |
|---|---|
| PubChem CID | 12884408 |
| Molecular Formula | C19H28N4O5S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | N-[2-[4-(butylcarbamoylsulfamoyl)phenyl]ethyl]-2-oxopiperidine-1-carboxamide |
| SMILES | CCCCNC(=O)NS(=O)(=O)c1ccc(CCNC(=O)N2CCCCC2=O)cc1 |
| InChI | InChI=1S/C19H28N4O5S/c1-2-3-12-20-18(25)22-29(27,28)16-9-7-15(8-10-16)11-13-21-19(26)23-14-5-4-6-17(23)24/h7-10H,2-6,11-14H2,1H3,(H,21,26)(H2,20,22,25) |
| InChIKey | DPTFTKLPMYIYDZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|