About (4R)-2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-amine
(4R)-2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-amine (PubChem CID 12884652) has the molecular formula C16H18N2
and a molecular weight of 238.33 g/mol. Its IUPAC name is (4R)-2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-amine.
Molecular Properties
| Compound Name | (4R)-2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-amine |
| PubChem CID | 12884652 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | (4R)-2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-amine |
| SMILES | CN1Cc2c(N)cccc2[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C16H18N2/c1-18-10-14(12-6-3-2-4-7-12)13-8-5-9-16(17)15(13)11-18/h2-9,14H,10-11,17H2,1H3/t14-/m1/s1 |
| InChIKey | XXPANQJNYNUNES-CQSZACIVSA-N |
| XLogP | 2.85 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4R)-2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-amine?
The IUPAC name of (4R)-2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-amine (CID 12884652) is (4R)-2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-amine.
What is the SMILES notation for (4R)-2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-amine?
The canonical SMILES for (4R)-2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-amine is CN1Cc2c(N)cccc2[C@@H](c2ccccc2)C1.
What is the InChIKey of (4R)-2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-amine?
The InChIKey is XXPANQJNYNUNES-CQSZACIVSA-N. The full InChI is InChI=1S/C16H18N2/c1-18-10-14(12-6-3-2-4-7-12)13-8-5-9-16(17)15(13)11-18/h2-9,14H,10-11,17H2,1H3/t14-/m1/s1.
What are the key properties of (4R)-2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-amine?
(4R)-2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-amine has a molecular weight of 238.33 g/mol, XLogP of 2.85, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-amine is sourced from PubChem (CID 12884652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).