About 3-[2-(azetidin-1-yl)-2-oxoethyl]-1,3-thiazolidin-4-one
3-[2-(azetidin-1-yl)-2-oxoethyl]-1,3-thiazolidin-4-one (PubChem CID 128848247) has the molecular formula C8H12N2O2S
and a molecular weight of 200.26 g/mol. Its IUPAC name is 3-[2-(azetidin-1-yl)-2-oxoethyl]-1,3-thiazolidin-4-one.
Analyze 3-[2-(azetidin-1-yl)-2-oxoethyl]-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(azetidin-1-yl)-2-oxoethyl]-1,3-thiazolidin-4-one?
The IUPAC name of 3-[2-(azetidin-1-yl)-2-oxoethyl]-1,3-thiazolidin-4-one (CID 128848247) is 3-[2-(azetidin-1-yl)-2-oxoethyl]-1,3-thiazolidin-4-one.
What is the SMILES notation for 3-[2-(azetidin-1-yl)-2-oxoethyl]-1,3-thiazolidin-4-one?
The canonical SMILES for 3-[2-(azetidin-1-yl)-2-oxoethyl]-1,3-thiazolidin-4-one is O=C(CN1CSCC1=O)N1CCC1.
What is the InChIKey of 3-[2-(azetidin-1-yl)-2-oxoethyl]-1,3-thiazolidin-4-one?
The InChIKey is UVBSAFABUNYYSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S/c11-7(9-2-1-3-9)4-10-6-13-5-8(10)12/h1-6H2.
What are the key properties of 3-[2-(azetidin-1-yl)-2-oxoethyl]-1,3-thiazolidin-4-one?
3-[2-(azetidin-1-yl)-2-oxoethyl]-1,3-thiazolidin-4-one has a molecular weight of 200.26 g/mol, XLogP of -0.25, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(azetidin-1-yl)-2-oxoethyl]-1,3-thiazolidin-4-one is sourced from PubChem (CID 128848247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).