C16H16N4O2 — CID 12884988
1,5-dibenzyl-1,2,4,5-tetrazinane-3,6-dione (PubChem CID 12884988) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is 1,5-dibenzyl-1,2,4,5-tetrazinane-3,6-dione.
| Compound Name | 1,5-dibenzyl-1,2,4,5-tetrazinane-3,6-dione |
|---|---|
| PubChem CID | 12884988 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 1,5-dibenzyl-1,2,4,5-tetrazinane-3,6-dione |
| SMILES | O=C1NN(Cc2ccccc2)C(=O)N(Cc2ccccc2)N1 |
| InChI | InChI=1S/C16H16N4O2/c21-15-17-19(11-13-7-3-1-4-8-13)16(22)20(18-15)12-14-9-5-2-6-10-14/h1-10H,11-12H2,(H2,17,18,21) |
| InChIKey | FDFBVEJNYJIMMH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |