C11H6F4O — CID 12885698
3,4,5,6-tetrafluorotricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-11-one (PubChem CID 12885698) has the molecular formula C11H6F4O and a molecular weight of 230.16 g/mol. Its IUPAC name is 3,4,5,6-tetrafluorotricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-11-one.
| Compound Name | 3,4,5,6-tetrafluorotricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-11-one |
|---|---|
| PubChem CID | 12885698 |
| Molecular Formula | C11H6F4O |
| Molecular Weight | 230.16 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 3,4,5,6-tetrafluorotricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-11-one |
| SMILES | O=C1C2CCC1c1c(F)c(F)c(F)c(F)c12 |
| InChI | InChI=1S/C11H6F4O/c12-7-5-3-1-2-4(11(3)16)6(5)8(13)10(15)9(7)14/h3-4H,1-2H2 |
| InChIKey | PRQHCVAXAMLDMF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.16 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|