About (3S,4R)-4-methyl-1,1-dioxo-N-spiro[3.5]nonan-2-ylthiolan-3-amine
(3S,4R)-4-methyl-1,1-dioxo-N-spiro[3.5]nonan-2-ylthiolan-3-amine (PubChem CID 128860817) has the molecular formula C14H25NO2S
and a molecular weight of 271.43 g/mol. Its IUPAC name is (3S,4R)-4-methyl-1,1-dioxo-N-spiro[3.5]nonan-2-ylthiolan-3-amine.
Molecular Properties
| Compound Name | (3S,4R)-4-methyl-1,1-dioxo-N-spiro[3.5]nonan-2-ylthiolan-3-amine |
| PubChem CID | 128860817 |
| Molecular Formula | C14H25NO2S |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (3S,4R)-4-methyl-1,1-dioxo-N-spiro[3.5]nonan-2-ylthiolan-3-amine |
| SMILES | C[C@H]1CS(=O)(=O)C[C@H]1NC1CC2(CCCCC2)C1 |
| InChI | InChI=1S/C14H25NO2S/c1-11-9-18(16,17)10-13(11)15-12-7-14(8-12)5-3-2-4-6-14/h11-13,15H,2-10H2,1H3/t11-,13+/m0/s1 |
| InChIKey | GPEJYKVBPFDENQ-WCQYABFASA-N |
| XLogP | 2.12 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S,4R)-4-methyl-1,1-dioxo-N-spiro[3.5]nonan-2-ylthiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-4-methyl-1,1-dioxo-N-spiro[3.5]nonan-2-ylthiolan-3-amine?
The IUPAC name of (3S,4R)-4-methyl-1,1-dioxo-N-spiro[3.5]nonan-2-ylthiolan-3-amine (CID 128860817) is (3S,4R)-4-methyl-1,1-dioxo-N-spiro[3.5]nonan-2-ylthiolan-3-amine.
What is the SMILES notation for (3S,4R)-4-methyl-1,1-dioxo-N-spiro[3.5]nonan-2-ylthiolan-3-amine?
The canonical SMILES for (3S,4R)-4-methyl-1,1-dioxo-N-spiro[3.5]nonan-2-ylthiolan-3-amine is C[C@H]1CS(=O)(=O)C[C@H]1NC1CC2(CCCCC2)C1.
What is the InChIKey of (3S,4R)-4-methyl-1,1-dioxo-N-spiro[3.5]nonan-2-ylthiolan-3-amine?
The InChIKey is GPEJYKVBPFDENQ-WCQYABFASA-N. The full InChI is InChI=1S/C14H25NO2S/c1-11-9-18(16,17)10-13(11)15-12-7-14(8-12)5-3-2-4-6-14/h11-13,15H,2-10H2,1H3/t11-,13+/m0/s1.
What are the key properties of (3S,4R)-4-methyl-1,1-dioxo-N-spiro[3.5]nonan-2-ylthiolan-3-amine?
(3S,4R)-4-methyl-1,1-dioxo-N-spiro[3.5]nonan-2-ylthiolan-3-amine has a molecular weight of 271.43 g/mol, XLogP of 2.12, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-4-methyl-1,1-dioxo-N-spiro[3.5]nonan-2-ylthiolan-3-amine is sourced from PubChem (CID 128860817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).