C14H19NO2 — CID 12886748
5-hexyl-2-methyl-1,3-benzoxazol-6-ol (PubChem CID 12886748) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 5-hexyl-2-methyl-1,3-benzoxazol-6-ol.
| Compound Name | 5-hexyl-2-methyl-1,3-benzoxazol-6-ol |
|---|---|
| PubChem CID | 12886748 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 5-hexyl-2-methyl-1,3-benzoxazol-6-ol |
| SMILES | CCCCCCc1cc2nc(C)oc2cc1O |
| InChI | InChI=1S/C14H19NO2/c1-3-4-5-6-7-11-8-12-14(9-13(11)16)17-10(2)15-12/h8-9,16H,3-7H2,1-2H3 |
| InChIKey | UDYONFWNEBMVKP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|