ethyl 1,4-diphenylpyrazole-3-carboxylate

C18H16N2O2 — CID 12886935

IUPACethyl 1,4-diphenylpyrazole-3-carboxylate
SMILESCCOC(=O)c1nn(-c2ccccc2)cc1-c1ccccc1
InChIInChI=1S/C18H16N2O2/c1-2-22-18(21)17-16(14-9-5-3-6-10-14)13-20(19-17)15-11-7-4-8-12-15/h3-13H,2H2,1H3
InChIKeyQNDYBLUTYVPPCI-UHFFFAOYSA-N
MW292.34 g/mol
LogP3.72
Rot. Bonds4

About ethyl 1,4-diphenylpyrazole-3-carboxylate

ethyl 1,4-diphenylpyrazole-3-carboxylate (PubChem CID 12886935) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is ethyl 1,4-diphenylpyrazole-3-carboxylate.

Molecular Properties

Compound Nameethyl 1,4-diphenylpyrazole-3-carboxylate
PubChem CID12886935
Molecular FormulaC18H16N2O2
Molecular Weight292.34 g/mol
Exact Mass292.12
IUPAC Nameethyl 1,4-diphenylpyrazole-3-carboxylate
SMILESCCOC(=O)c1nn(-c2ccccc2)cc1-c1ccccc1
InChIInChI=1S/C18H16N2O2/c1-2-22-18(21)17-16(14-9-5-3-6-10-14)13-20(19-17)15-11-7-4-8-12-15/h3-13H,2H2,1H3
InChIKeyQNDYBLUTYVPPCI-UHFFFAOYSA-N
XLogP3.72
TPSA44.12 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.34
LogP ≤ 53.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethyl 1,4-diphenylpyrazole-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 1,4-diphenylpyrazole-3-carboxylate?
The IUPAC name of ethyl 1,4-diphenylpyrazole-3-carboxylate (CID 12886935) is ethyl 1,4-diphenylpyrazole-3-carboxylate.
What is the SMILES notation for ethyl 1,4-diphenylpyrazole-3-carboxylate?
The canonical SMILES for ethyl 1,4-diphenylpyrazole-3-carboxylate is CCOC(=O)c1nn(-c2ccccc2)cc1-c1ccccc1.
What is the InChIKey of ethyl 1,4-diphenylpyrazole-3-carboxylate?
The InChIKey is QNDYBLUTYVPPCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O2/c1-2-22-18(21)17-16(14-9-5-3-6-10-14)13-20(19-17)15-11-7-4-8-12-15/h3-13H,2H2,1H3.
What are the key properties of ethyl 1,4-diphenylpyrazole-3-carboxylate?
ethyl 1,4-diphenylpyrazole-3-carboxylate has a molecular weight of 292.34 g/mol, XLogP of 3.72, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1,4-diphenylpyrazole-3-carboxylate is sourced from PubChem (CID 12886935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).