C21H19N3O4 — CID 1288703
N-(1-cyano-9,10-dimethoxy-2,3,6,7-tetrahydrobenzo[a]quinolizin-4-ylidene)furan-2-carboxamide (PubChem CID 1288703) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is N-(1-cyano-9,10-dimethoxy-2,3,6,7-tetrahydrobenzo[a]quinolizin-4-ylidene)furan-2-carboxamide.
| Compound Name | N-(1-cyano-9,10-dimethoxy-2,3,6,7-tetrahydrobenzo[a]quinolizin-4-ylidene)furan-2-carboxamide |
|---|---|
| PubChem CID | 1288703 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-(1-cyano-9,10-dimethoxy-2,3,6,7-tetrahydrobenzo[a]quinolizin-4-ylidene)furan-2-carboxamide |
| SMILES | COc1cc2c(cc1OC)C1=C(C#N)CC/C(=N\C(=O)c3ccco3)N1CC2 |
| InChI | InChI=1S/C21H19N3O4/c1-26-17-10-13-7-8-24-19(23-21(25)16-4-3-9-28-16)6-5-14(12-22)20(24)15(13)11-18(17)27-2/h3-4,9-11H,5-8H2,1-2H3/b23-19+ |
| InChIKey | WGGNKLWMPCYJNG-FCDQGJHFSA-N |
| XLogP | 3.42 |
| TPSA | 88.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|