About 2,4-dibenzyl-4H-1,3-oxazol-5-one
2,4-dibenzyl-4H-1,3-oxazol-5-one (PubChem CID 12887263) has the molecular formula C17H15NO2
and a molecular weight of 265.31 g/mol. Its IUPAC name is 2,4-dibenzyl-4H-1,3-oxazol-5-one.
Molecular Properties
| Compound Name | 2,4-dibenzyl-4H-1,3-oxazol-5-one |
| PubChem CID | 12887263 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2,4-dibenzyl-4H-1,3-oxazol-5-one |
| SMILES | O=C1OC(Cc2ccccc2)=NC1Cc1ccccc1 |
| InChI | InChI=1S/C17H15NO2/c19-17-15(11-13-7-3-1-4-8-13)18-16(20-17)12-14-9-5-2-6-10-14/h1-10,15H,11-12H2 |
| InChIKey | NJPDNFPNUXIASL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dibenzyl-4H-1,3-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dibenzyl-4H-1,3-oxazol-5-one?
The IUPAC name of 2,4-dibenzyl-4H-1,3-oxazol-5-one (CID 12887263) is 2,4-dibenzyl-4H-1,3-oxazol-5-one.
What is the SMILES notation for 2,4-dibenzyl-4H-1,3-oxazol-5-one?
The canonical SMILES for 2,4-dibenzyl-4H-1,3-oxazol-5-one is O=C1OC(Cc2ccccc2)=NC1Cc1ccccc1.
What is the InChIKey of 2,4-dibenzyl-4H-1,3-oxazol-5-one?
The InChIKey is NJPDNFPNUXIASL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO2/c19-17-15(11-13-7-3-1-4-8-13)18-16(20-17)12-14-9-5-2-6-10-14/h1-10,15H,11-12H2.
What are the key properties of 2,4-dibenzyl-4H-1,3-oxazol-5-one?
2,4-dibenzyl-4H-1,3-oxazol-5-one has a molecular weight of 265.31 g/mol, XLogP of 2.80, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibenzyl-4H-1,3-oxazol-5-one is sourced from PubChem (CID 12887263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).