C6H14N2 — CID 12887441
(E)-N,N,N',N'-tetramethylethene-1,2-diamine (PubChem CID 12887441) has the molecular formula C6H14N2 and a molecular weight of 114.19 g/mol. Its IUPAC name is (E)-N,N,N',N'-tetramethylethene-1,2-diamine.
| Compound Name | (E)-N,N,N',N'-tetramethylethene-1,2-diamine |
|---|---|
| PubChem CID | 12887441 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | (E)-N,N,N',N'-tetramethylethene-1,2-diamine |
| SMILES | CN(C)/C=C/N(C)C |
| InChI | InChI=1S/C6H14N2/c1-7(2)5-6-8(3)4/h5-6H,1-4H3/b6-5+ |
| InChIKey | VJNYTMGAKLYZRS-AATRIKPKSA-N |
| XLogP | 0.58 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |