C9H10N4 — CID 12887461
5-phenyl-1H-pyrazole-3,4-diamine (PubChem CID 12887461) has the molecular formula C9H10N4 and a molecular weight of 174.21 g/mol. Its IUPAC name is 5-phenyl-1H-pyrazole-3,4-diamine.
| Compound Name | 5-phenyl-1H-pyrazole-3,4-diamine |
|---|---|
| PubChem CID | 12887461 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 5-phenyl-1H-pyrazole-3,4-diamine |
| SMILES | Nc1n[nH]c(-c2ccccc2)c1N |
| InChI | InChI=1S/C9H10N4/c10-7-8(12-13-9(7)11)6-4-2-1-3-5-6/h1-5H,10H2,(H3,11,12,13) |
| InChIKey | SGJNUIVHFDXMRC-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |