3-(1,2,4-triazol-4-yl)propanoic acid

C5H7N3O2 — CID 12888410

IUPAC3-(1,2,4-triazol-4-yl)propanoic acid
SMILESO=C(O)CCn1cnnc1
InChIInChI=1S/C5H7N3O2/c9-5(10)1-2-8-3-6-7-4-8/h3-4H,1-2H2,(H,9,10)
InChIKeyDMFCJCKBQKPLLV-UHFFFAOYSA-N
MW141.13 g/mol
LogP-0.25
Rot. Bonds3

About 3-(1,2,4-triazol-4-yl)propanoic acid

3-(1,2,4-triazol-4-yl)propanoic acid (PubChem CID 12888410) has the molecular formula C5H7N3O2 and a molecular weight of 141.13 g/mol. Its IUPAC name is 3-(1,2,4-triazol-4-yl)propanoic acid.

Molecular Properties

Compound Name3-(1,2,4-triazol-4-yl)propanoic acid
PubChem CID12888410
Molecular FormulaC5H7N3O2
Molecular Weight141.13 g/mol
Exact Mass141.05
IUPAC Name3-(1,2,4-triazol-4-yl)propanoic acid
SMILESO=C(O)CCn1cnnc1
InChIInChI=1S/C5H7N3O2/c9-5(10)1-2-8-3-6-7-4-8/h3-4H,1-2H2,(H,9,10)
InChIKeyDMFCJCKBQKPLLV-UHFFFAOYSA-N
XLogP-0.25
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500141.13
LogP ≤ 5-0.25
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(1,2,4-triazol-4-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1,2,4-triazol-4-yl)propanoic acid?
The IUPAC name of 3-(1,2,4-triazol-4-yl)propanoic acid (CID 12888410) is 3-(1,2,4-triazol-4-yl)propanoic acid.
What is the SMILES notation for 3-(1,2,4-triazol-4-yl)propanoic acid?
The canonical SMILES for 3-(1,2,4-triazol-4-yl)propanoic acid is O=C(O)CCn1cnnc1.
What is the InChIKey of 3-(1,2,4-triazol-4-yl)propanoic acid?
The InChIKey is DMFCJCKBQKPLLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O2/c9-5(10)1-2-8-3-6-7-4-8/h3-4H,1-2H2,(H,9,10).
What are the key properties of 3-(1,2,4-triazol-4-yl)propanoic acid?
3-(1,2,4-triazol-4-yl)propanoic acid has a molecular weight of 141.13 g/mol, XLogP of -0.25, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2,4-triazol-4-yl)propanoic acid is sourced from PubChem (CID 12888410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).