About S-(4-butyl-1,2,4-triazol-3-yl) ethanethioate
S-(4-butyl-1,2,4-triazol-3-yl) ethanethioate (PubChem CID 12888454) has the molecular formula C8H13N3OS
and a molecular weight of 199.28 g/mol. Its IUPAC name is S-(4-butyl-1,2,4-triazol-3-yl) ethanethioate.
Molecular Properties
| Compound Name | S-(4-butyl-1,2,4-triazol-3-yl) ethanethioate |
| PubChem CID | 12888454 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | S-(4-butyl-1,2,4-triazol-3-yl) ethanethioate |
| SMILES | CCCCn1cnnc1SC(C)=O |
| InChI | InChI=1S/C8H13N3OS/c1-3-4-5-11-6-9-10-8(11)13-7(2)12/h6H,3-5H2,1-2H3 |
| InChIKey | HFNIVBTZLMXJTJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-butyl-1,2,4-triazol-3-yl) ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-butyl-1,2,4-triazol-3-yl) ethanethioate?
The IUPAC name of S-(4-butyl-1,2,4-triazol-3-yl) ethanethioate (CID 12888454) is S-(4-butyl-1,2,4-triazol-3-yl) ethanethioate.
What is the SMILES notation for S-(4-butyl-1,2,4-triazol-3-yl) ethanethioate?
The canonical SMILES for S-(4-butyl-1,2,4-triazol-3-yl) ethanethioate is CCCCn1cnnc1SC(C)=O.
What is the InChIKey of S-(4-butyl-1,2,4-triazol-3-yl) ethanethioate?
The InChIKey is HFNIVBTZLMXJTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3OS/c1-3-4-5-11-6-9-10-8(11)13-7(2)12/h6H,3-5H2,1-2H3.
What are the key properties of S-(4-butyl-1,2,4-triazol-3-yl) ethanethioate?
S-(4-butyl-1,2,4-triazol-3-yl) ethanethioate has a molecular weight of 199.28 g/mol, XLogP of 1.72, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-butyl-1,2,4-triazol-3-yl) ethanethioate is sourced from PubChem (CID 12888454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).