C32H27NO5 — CID 1288913
(4-formylphenyl) 4-[(15R,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]cyclohexane-1-carboxylate (PubChem CID 1288913) has the molecular formula C32H27NO5 and a molecular weight of 505.57 g/mol. Its IUPAC name is (4-formylphenyl) 4-[(15R,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]cyclohexane-1-carboxylate.
| Compound Name | (4-formylphenyl) 4-[(15R,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 1288913 |
| Molecular Formula | C32H27NO5 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | (4-formylphenyl) 4-[(15R,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]cyclohexane-1-carboxylate |
| SMILES | O=Cc1ccc(OC(=O)C2CCC(N3C(=O)[C@@H]4C5c6ccccc6C(c6ccccc65)[C@H]4C3=O)CC2)cc1 |
| InChI | InChI=1S/C32H27NO5/c34-17-18-9-15-21(16-10-18)38-32(37)19-11-13-20(14-12-19)33-30(35)28-26-22-5-1-2-6-23(22)27(29(28)31(33)36)25-8-4-3-7-24(25)26/h1-10,15-17,19-20,26-29H,11-14H2/t19?,20?,26?,27?,28-,29-/m1/s1 |
| InChIKey | NEUGSECSQNPZSK-LFPYEKEISA-N |
| XLogP | 4.86 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|