C15H12F2N2O4 — CID 128892695
[(3aS,9aR)-5,8-difluoro-1,3,3a,9a-tetrahydro-[1,4]benzodioxino[2,3-c]pyrrol-2-yl]-(4-methyl-1,3-oxazol-5-yl)methanone (PubChem CID 128892695) has the molecular formula C15H12F2N2O4 and a molecular weight of 322.27 g/mol. Its IUPAC name is [(3aS,9aR)-5,8-difluoro-1,3,3a,9a-tetrahydro-[1,4]benzodioxino[2,3-c]pyrrol-2-yl]-(4-methyl-1,3-oxazol-5-yl)methanone.
| Compound Name | [(3aS,9aR)-5,8-difluoro-1,3,3a,9a-tetrahydro-[1,4]benzodioxino[2,3-c]pyrrol-2-yl]-(4-methyl-1,3-oxazol-5-yl)methanone |
|---|---|
| PubChem CID | 128892695 |
| Molecular Formula | C15H12F2N2O4 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | [(3aS,9aR)-5,8-difluoro-1,3,3a,9a-tetrahydro-[1,4]benzodioxino[2,3-c]pyrrol-2-yl]-(4-methyl-1,3-oxazol-5-yl)methanone |
| SMILES | Cc1ncoc1C(=O)N1C[C@@H]2Oc3c(F)ccc(F)c3O[C@@H]2C1 |
| InChI | InChI=1S/C15H12F2N2O4/c1-7-12(21-6-18-7)15(20)19-4-10-11(5-19)23-14-9(17)3-2-8(16)13(14)22-10/h2-3,6,10-11H,4-5H2,1H3/t10-,11+ |
| InChIKey | BDOOEYIERZAOPT-PHIMTYICSA-N |
| XLogP | 1.93 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |