About [3-methoxy-4-[methoxysulfonyloxy(dimethyl)-lambda4-sulfanyl]phenyl] N,N-dimethylcarbamate
[3-methoxy-4-[methoxysulfonyloxy(dimethyl)-lambda4-sulfanyl]phenyl] N,N-dimethylcarbamate (PubChem CID 12889728) has the molecular formula C13H21NO7S2
and a molecular weight of 367.45 g/mol. Its IUPAC name is [3-methoxy-4-[methoxysulfonyloxy(dimethyl)-lambda4-sulfanyl]phenyl] N,N-dimethylcarbamate.
Molecular Properties
| Compound Name | [3-methoxy-4-[methoxysulfonyloxy(dimethyl)-lambda4-sulfanyl]phenyl] N,N-dimethylcarbamate |
| PubChem CID | 12889728 |
| Molecular Formula | C13H21NO7S2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | [3-methoxy-4-[methoxysulfonyloxy(dimethyl)-lambda4-sulfanyl]phenyl] N,N-dimethylcarbamate |
| SMILES | COc1cc(OC(=O)N(C)C)ccc1S(C)(C)OS(=O)(=O)OC |
| InChI | InChI=1S/C13H21NO7S2/c1-14(2)13(15)20-10-7-8-12(11(9-10)18-3)22(5,6)21-23(16,17)19-4/h7-9H,1-6H3 |
| InChIKey | ICLXYXSCARVOOH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [3-methoxy-4-[methoxysulfonyloxy(dimethyl)-lambda4-sulfanyl]phenyl] N,N-dimethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methoxy-4-[methoxysulfonyloxy(dimethyl)-lambda4-sulfanyl]phenyl] N,N-dimethylcarbamate?
The IUPAC name of [3-methoxy-4-[methoxysulfonyloxy(dimethyl)-lambda4-sulfanyl]phenyl] N,N-dimethylcarbamate (CID 12889728) is [3-methoxy-4-[methoxysulfonyloxy(dimethyl)-lambda4-sulfanyl]phenyl] N,N-dimethylcarbamate.
What is the SMILES notation for [3-methoxy-4-[methoxysulfonyloxy(dimethyl)-lambda4-sulfanyl]phenyl] N,N-dimethylcarbamate?
The canonical SMILES for [3-methoxy-4-[methoxysulfonyloxy(dimethyl)-lambda4-sulfanyl]phenyl] N,N-dimethylcarbamate is COc1cc(OC(=O)N(C)C)ccc1S(C)(C)OS(=O)(=O)OC.
What is the InChIKey of [3-methoxy-4-[methoxysulfonyloxy(dimethyl)-lambda4-sulfanyl]phenyl] N,N-dimethylcarbamate?
The InChIKey is ICLXYXSCARVOOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO7S2/c1-14(2)13(15)20-10-7-8-12(11(9-10)18-3)22(5,6)21-23(16,17)19-4/h7-9H,1-6H3.
What are the key properties of [3-methoxy-4-[methoxysulfonyloxy(dimethyl)-lambda4-sulfanyl]phenyl] N,N-dimethylcarbamate?
[3-methoxy-4-[methoxysulfonyloxy(dimethyl)-lambda4-sulfanyl]phenyl] N,N-dimethylcarbamate has a molecular weight of 367.45 g/mol, XLogP of 2.00, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methoxy-4-[methoxysulfonyloxy(dimethyl)-lambda4-sulfanyl]phenyl] N,N-dimethylcarbamate is sourced from PubChem (CID 12889728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).