About 2-bromo-1,3-diphenylpropane-1,3-dione
2-bromo-1,3-diphenylpropane-1,3-dione (PubChem CID 12890) has the molecular formula C15H11BrO2
and a molecular weight of 303.16 g/mol. Its IUPAC name is 2-bromo-1,3-diphenylpropane-1,3-dione.
Molecular Properties
| Compound Name | 2-bromo-1,3-diphenylpropane-1,3-dione |
| PubChem CID | 12890 |
| Molecular Formula | C15H11BrO2 |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | 2-bromo-1,3-diphenylpropane-1,3-dione |
| SMILES | O=C(c1ccccc1)C(Br)C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H11BrO2/c16-13(14(17)11-7-3-1-4-8-11)15(18)12-9-5-2-6-10-12/h1-10,13H |
| InChIKey | BYAJHZYXPBREEK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1,3-diphenylpropane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1,3-diphenylpropane-1,3-dione?
The IUPAC name of 2-bromo-1,3-diphenylpropane-1,3-dione (CID 12890) is 2-bromo-1,3-diphenylpropane-1,3-dione.
What is the SMILES notation for 2-bromo-1,3-diphenylpropane-1,3-dione?
The canonical SMILES for 2-bromo-1,3-diphenylpropane-1,3-dione is O=C(c1ccccc1)C(Br)C(=O)c1ccccc1.
What is the InChIKey of 2-bromo-1,3-diphenylpropane-1,3-dione?
The InChIKey is BYAJHZYXPBREEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11BrO2/c16-13(14(17)11-7-3-1-4-8-11)15(18)12-9-5-2-6-10-12/h1-10,13H.
What are the key properties of 2-bromo-1,3-diphenylpropane-1,3-dione?
2-bromo-1,3-diphenylpropane-1,3-dione has a molecular weight of 303.16 g/mol, XLogP of 3.52, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1,3-diphenylpropane-1,3-dione is sourced from PubChem (CID 12890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).