About 3-(3-acetylsulfanylpropanoyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid
3-(3-acetylsulfanylpropanoyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 12890009) has the molecular formula C11H17NO4S2
and a molecular weight of 291.39 g/mol. Its IUPAC name is 3-(3-acetylsulfanylpropanoyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 3-(3-acetylsulfanylpropanoyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| PubChem CID | 12890009 |
| Molecular Formula | C11H17NO4S2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 3-(3-acetylsulfanylpropanoyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC(=O)SCCC(=O)N1CSC(C)(C)C1C(=O)O |
| InChI | InChI=1S/C11H17NO4S2/c1-7(13)17-5-4-8(14)12-6-18-11(2,3)9(12)10(15)16/h9H,4-6H2,1-3H3,(H,15,16) |
| InChIKey | IAGLMBFTLHSJJX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-acetylsulfanylpropanoyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-acetylsulfanylpropanoyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of 3-(3-acetylsulfanylpropanoyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid (CID 12890009) is 3-(3-acetylsulfanylpropanoyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for 3-(3-acetylsulfanylpropanoyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for 3-(3-acetylsulfanylpropanoyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid is CC(=O)SCCC(=O)N1CSC(C)(C)C1C(=O)O.
What is the InChIKey of 3-(3-acetylsulfanylpropanoyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is IAGLMBFTLHSJJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO4S2/c1-7(13)17-5-4-8(14)12-6-18-11(2,3)9(12)10(15)16/h9H,4-6H2,1-3H3,(H,15,16).
What are the key properties of 3-(3-acetylsulfanylpropanoyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid?
3-(3-acetylsulfanylpropanoyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 291.39 g/mol, XLogP of 1.42, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-acetylsulfanylpropanoyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 12890009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).