About 5-[[(2R,3R)-2-(4-chlorophenyl)-3-hydroxypyrrolidin-1-yl]methyl]azepan-2-one
5-[[(2R,3R)-2-(4-chlorophenyl)-3-hydroxypyrrolidin-1-yl]methyl]azepan-2-one (PubChem CID 128907443) has the molecular formula C17H23ClN2O2
and a molecular weight of 322.84 g/mol. Its IUPAC name is 5-[[(2R,3R)-2-(4-chlorophenyl)-3-hydroxypyrrolidin-1-yl]methyl]azepan-2-one.
Molecular Properties
| Compound Name | 5-[[(2R,3R)-2-(4-chlorophenyl)-3-hydroxypyrrolidin-1-yl]methyl]azepan-2-one |
| PubChem CID | 128907443 |
| Molecular Formula | C17H23ClN2O2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 5-[[(2R,3R)-2-(4-chlorophenyl)-3-hydroxypyrrolidin-1-yl]methyl]azepan-2-one |
| SMILES | O=C1CCC(CN2CC[C@@H](O)[C@H]2c2ccc(Cl)cc2)CCN1 |
| InChI | InChI=1S/C17H23ClN2O2/c18-14-4-2-13(3-5-14)17-15(21)8-10-20(17)11-12-1-6-16(22)19-9-7-12/h2-5,12,15,17,21H,1,6-11H2,(H,19,22)/t12?,15-,17-/m1/s1 |
| InChIKey | QWTUYJQMEWNXBM-VUOSCMKMSA-N |
| XLogP | 2.36 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[[(2R,3R)-2-(4-chlorophenyl)-3-hydroxypyrrolidin-1-yl]methyl]azepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(2R,3R)-2-(4-chlorophenyl)-3-hydroxypyrrolidin-1-yl]methyl]azepan-2-one?
The IUPAC name of 5-[[(2R,3R)-2-(4-chlorophenyl)-3-hydroxypyrrolidin-1-yl]methyl]azepan-2-one (CID 128907443) is 5-[[(2R,3R)-2-(4-chlorophenyl)-3-hydroxypyrrolidin-1-yl]methyl]azepan-2-one.
What is the SMILES notation for 5-[[(2R,3R)-2-(4-chlorophenyl)-3-hydroxypyrrolidin-1-yl]methyl]azepan-2-one?
The canonical SMILES for 5-[[(2R,3R)-2-(4-chlorophenyl)-3-hydroxypyrrolidin-1-yl]methyl]azepan-2-one is O=C1CCC(CN2CC[C@@H](O)[C@H]2c2ccc(Cl)cc2)CCN1.
What is the InChIKey of 5-[[(2R,3R)-2-(4-chlorophenyl)-3-hydroxypyrrolidin-1-yl]methyl]azepan-2-one?
The InChIKey is QWTUYJQMEWNXBM-VUOSCMKMSA-N. The full InChI is InChI=1S/C17H23ClN2O2/c18-14-4-2-13(3-5-14)17-15(21)8-10-20(17)11-12-1-6-16(22)19-9-7-12/h2-5,12,15,17,21H,1,6-11H2,(H,19,22)/t12?,15-,17-/m1/s1.
What are the key properties of 5-[[(2R,3R)-2-(4-chlorophenyl)-3-hydroxypyrrolidin-1-yl]methyl]azepan-2-one?
5-[[(2R,3R)-2-(4-chlorophenyl)-3-hydroxypyrrolidin-1-yl]methyl]azepan-2-one has a molecular weight of 322.84 g/mol, XLogP of 2.36, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(2R,3R)-2-(4-chlorophenyl)-3-hydroxypyrrolidin-1-yl]methyl]azepan-2-one is sourced from PubChem (CID 128907443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).