C14H23N3O4 — CID 128915358
1-[[(1R,2S)-2-hydroxycyclohexyl]methyl]-3-(1-methyl-2,6-dioxopiperidin-3-yl)urea (PubChem CID 128915358) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is 1-[[(1R,2S)-2-hydroxycyclohexyl]methyl]-3-(1-methyl-2,6-dioxopiperidin-3-yl)urea.
| Compound Name | 1-[[(1R,2S)-2-hydroxycyclohexyl]methyl]-3-(1-methyl-2,6-dioxopiperidin-3-yl)urea |
|---|---|
| PubChem CID | 128915358 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 1-[[(1R,2S)-2-hydroxycyclohexyl]methyl]-3-(1-methyl-2,6-dioxopiperidin-3-yl)urea |
| SMILES | CN1C(=O)CCC(NC(=O)NC[C@H]2CCCC[C@@H]2O)C1=O |
| InChI | InChI=1S/C14H23N3O4/c1-17-12(19)7-6-10(13(17)20)16-14(21)15-8-9-4-2-3-5-11(9)18/h9-11,18H,2-8H2,1H3,(H2,15,16,21)/t9-,10?,11+/m1/s1 |
| InChIKey | BCKOUPQNNGVNDL-FBKFWFMHSA-N |
| XLogP | -0.02 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|