C12H12ClNO — CID 12891823
6-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-ol (PubChem CID 12891823) has the molecular formula C12H12ClNO and a molecular weight of 221.69 g/mol. Its IUPAC name is 6-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-ol.
| Compound Name | 6-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-ol |
|---|---|
| PubChem CID | 12891823 |
| Molecular Formula | C12H12ClNO |
| Molecular Weight | 221.69 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 6-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-ol |
| SMILES | OC1CCc2[nH]c3ccc(Cl)cc3c2C1 |
| InChI | InChI=1S/C12H12ClNO/c13-7-1-3-11-9(5-7)10-6-8(15)2-4-12(10)14-11/h1,3,5,8,14-15H,2,4,6H2 |
| InChIKey | RRLMGKSFHNZBGB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.69 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|