C17H19N3O4S — CID 12892054
diethyl 2-[(1,2-dihydroimidazo[2,1-b][1,3]benzothiazol-6-ylamino)methylidene]propanedioate (PubChem CID 12892054) has the molecular formula C17H19N3O4S and a molecular weight of 361.42 g/mol. Its IUPAC name is diethyl 2-[(1,2-dihydroimidazo[2,1-b][1,3]benzothiazol-6-ylamino)methylidene]propanedioate.
| Compound Name | diethyl 2-[(1,2-dihydroimidazo[2,1-b][1,3]benzothiazol-6-ylamino)methylidene]propanedioate |
|---|---|
| PubChem CID | 12892054 |
| Molecular Formula | C17H19N3O4S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | diethyl 2-[(1,2-dihydroimidazo[2,1-b][1,3]benzothiazol-6-ylamino)methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNc1ccc2c(c1)SC1=NCCN12)C(=O)OCC |
| InChI | InChI=1S/C17H19N3O4S/c1-3-23-15(21)12(16(22)24-4-2)10-19-11-5-6-13-14(9-11)25-17-18-7-8-20(13)17/h5-6,9-10,19H,3-4,7-8H2,1-2H3 |
| InChIKey | UCGVFPMAXNCZPU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|