C21H27N3O4S — CID 12892057
diethyl 2-[[(6-butyl-1,2-dihydroimidazo[2,1-b][1,3]benzothiazol-7-yl)amino]methylidene]propanedioate (PubChem CID 12892057) has the molecular formula C21H27N3O4S and a molecular weight of 417.53 g/mol. Its IUPAC name is diethyl 2-[[(6-butyl-1,2-dihydroimidazo[2,1-b][1,3]benzothiazol-7-yl)amino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[(6-butyl-1,2-dihydroimidazo[2,1-b][1,3]benzothiazol-7-yl)amino]methylidene]propanedioate |
|---|---|
| PubChem CID | 12892057 |
| Molecular Formula | C21H27N3O4S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | diethyl 2-[[(6-butyl-1,2-dihydroimidazo[2,1-b][1,3]benzothiazol-7-yl)amino]methylidene]propanedioate |
| SMILES | CCCCc1cc2c(cc1NC=C(C(=O)OCC)C(=O)OCC)N1CCN=C1S2 |
| InChI | InChI=1S/C21H27N3O4S/c1-4-7-8-14-11-18-17(24-10-9-22-21(24)29-18)12-16(14)23-13-15(19(25)27-5-2)20(26)28-6-3/h11-13,23H,4-10H2,1-3H3 |
| InChIKey | JGIXBHFALUJFHR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|