C23H31N3O4S — CID 12892060
diethyl 2-[[(6-hexyl-1,2-dihydroimidazo[2,1-b][1,3]benzothiazol-7-yl)amino]methylidene]propanedioate (PubChem CID 12892060) has the molecular formula C23H31N3O4S and a molecular weight of 445.59 g/mol. Its IUPAC name is diethyl 2-[[(6-hexyl-1,2-dihydroimidazo[2,1-b][1,3]benzothiazol-7-yl)amino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[(6-hexyl-1,2-dihydroimidazo[2,1-b][1,3]benzothiazol-7-yl)amino]methylidene]propanedioate |
|---|---|
| PubChem CID | 12892060 |
| Molecular Formula | C23H31N3O4S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | diethyl 2-[[(6-hexyl-1,2-dihydroimidazo[2,1-b][1,3]benzothiazol-7-yl)amino]methylidene]propanedioate |
| SMILES | CCCCCCc1cc2c(cc1NC=C(C(=O)OCC)C(=O)OCC)N1CCN=C1S2 |
| InChI | InChI=1S/C23H31N3O4S/c1-4-7-8-9-10-16-13-20-19(26-12-11-24-23(26)31-20)14-18(16)25-15-17(21(27)29-5-2)22(28)30-6-3/h13-15,25H,4-12H2,1-3H3 |
| InChIKey | NHFBJWBZVQUTTA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|