About 2,9-diazaspiro[4.5]decan-2-yl(1,3-thiazol-4-yl)methanone
2,9-diazaspiro[4.5]decan-2-yl(1,3-thiazol-4-yl)methanone (PubChem CID 128924626) has the molecular formula C12H17N3OS
and a molecular weight of 251.35 g/mol. Its IUPAC name is 2,9-diazaspiro[4.5]decan-2-yl(1,3-thiazol-4-yl)methanone.
Molecular Properties
| Compound Name | 2,9-diazaspiro[4.5]decan-2-yl(1,3-thiazol-4-yl)methanone |
| PubChem CID | 128924626 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 2,9-diazaspiro[4.5]decan-2-yl(1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1cscn1)N1CCC2(CCCNC2)C1 |
| InChI | InChI=1S/C12H17N3OS/c16-11(10-6-17-9-14-10)15-5-3-12(8-15)2-1-4-13-7-12/h6,9,13H,1-5,7-8H2 |
| InChIKey | RGQARLMUUBBMCY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,9-diazaspiro[4.5]decan-2-yl(1,3-thiazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,9-diazaspiro[4.5]decan-2-yl(1,3-thiazol-4-yl)methanone?
The IUPAC name of 2,9-diazaspiro[4.5]decan-2-yl(1,3-thiazol-4-yl)methanone (CID 128924626) is 2,9-diazaspiro[4.5]decan-2-yl(1,3-thiazol-4-yl)methanone.
What is the SMILES notation for 2,9-diazaspiro[4.5]decan-2-yl(1,3-thiazol-4-yl)methanone?
The canonical SMILES for 2,9-diazaspiro[4.5]decan-2-yl(1,3-thiazol-4-yl)methanone is O=C(c1cscn1)N1CCC2(CCCNC2)C1.
What is the InChIKey of 2,9-diazaspiro[4.5]decan-2-yl(1,3-thiazol-4-yl)methanone?
The InChIKey is RGQARLMUUBBMCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3OS/c16-11(10-6-17-9-14-10)15-5-3-12(8-15)2-1-4-13-7-12/h6,9,13H,1-5,7-8H2.
What are the key properties of 2,9-diazaspiro[4.5]decan-2-yl(1,3-thiazol-4-yl)methanone?
2,9-diazaspiro[4.5]decan-2-yl(1,3-thiazol-4-yl)methanone has a molecular weight of 251.35 g/mol, XLogP of 1.36, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,9-diazaspiro[4.5]decan-2-yl(1,3-thiazol-4-yl)methanone is sourced from PubChem (CID 128924626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).