About ethyl 5-methyl-4-oxohexanoate
ethyl 5-methyl-4-oxohexanoate (PubChem CID 12892835) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is ethyl 5-methyl-4-oxohexanoate.
Molecular Properties
| Compound Name | ethyl 5-methyl-4-oxohexanoate |
| PubChem CID | 12892835 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | ethyl 5-methyl-4-oxohexanoate |
| SMILES | CCOC(=O)CCC(=O)C(C)C |
| InChI | InChI=1S/C9H16O3/c1-4-12-9(11)6-5-8(10)7(2)3/h7H,4-6H2,1-3H3 |
| InChIKey | CSUUSMNNCCFVEB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 5-methyl-4-oxohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-methyl-4-oxohexanoate?
The IUPAC name of ethyl 5-methyl-4-oxohexanoate (CID 12892835) is ethyl 5-methyl-4-oxohexanoate.
What is the SMILES notation for ethyl 5-methyl-4-oxohexanoate?
The canonical SMILES for ethyl 5-methyl-4-oxohexanoate is CCOC(=O)CCC(=O)C(C)C.
What is the InChIKey of ethyl 5-methyl-4-oxohexanoate?
The InChIKey is CSUUSMNNCCFVEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3/c1-4-12-9(11)6-5-8(10)7(2)3/h7H,4-6H2,1-3H3.
What are the key properties of ethyl 5-methyl-4-oxohexanoate?
ethyl 5-methyl-4-oxohexanoate has a molecular weight of 172.22 g/mol, XLogP of 1.55, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-methyl-4-oxohexanoate is sourced from PubChem (CID 12892835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).