About N,N-diethylethanamine;phthalic acid
N,N-diethylethanamine;phthalic acid (PubChem CID 12892899) has the molecular formula C14H21NO4
and a molecular weight of 267.33 g/mol. Its IUPAC name is N,N-diethylethanamine;phthalic acid.
Molecular Properties
| Compound Name | N,N-diethylethanamine;phthalic acid |
| PubChem CID | 12892899 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | N,N-diethylethanamine;phthalic acid |
| SMILES | CCN(CC)CC.O=C(O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C8H6O4.C6H15N/c9-7(10)5-3-1-2-4-6(5)8(11)12;1-4-7(5-2)6-3/h1-4H,(H,9,10)(H,11,12);4-6H2,1-3H3 |
| InChIKey | JLIOOYQWWAUHRC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-diethylethanamine;phthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;phthalic acid?
The IUPAC name of N,N-diethylethanamine;phthalic acid (CID 12892899) is N,N-diethylethanamine;phthalic acid.
What is the SMILES notation for N,N-diethylethanamine;phthalic acid?
The canonical SMILES for N,N-diethylethanamine;phthalic acid is CCN(CC)CC.O=C(O)c1ccccc1C(=O)O.
What is the InChIKey of N,N-diethylethanamine;phthalic acid?
The InChIKey is JLIOOYQWWAUHRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4.C6H15N/c9-7(10)5-3-1-2-4-6(5)8(11)12;1-4-7(5-2)6-3/h1-4H,(H,9,10)(H,11,12);4-6H2,1-3H3.
What are the key properties of N,N-diethylethanamine;phthalic acid?
N,N-diethylethanamine;phthalic acid has a molecular weight of 267.33 g/mol, XLogP of 2.43, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;phthalic acid is sourced from PubChem (CID 12892899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).