C19H21N3O2S2 — CID 128935954
3-[[2-(4-propan-2-ylphenyl)-1,3-thiazol-5-yl]methyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 128935954) has the molecular formula C19H21N3O2S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 3-[[2-(4-propan-2-ylphenyl)-1,3-thiazol-5-yl]methyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-[[2-(4-propan-2-ylphenyl)-1,3-thiazol-5-yl]methyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 128935954 |
| Molecular Formula | C19H21N3O2S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 3-[[2-(4-propan-2-ylphenyl)-1,3-thiazol-5-yl]methyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | CC(C)c1ccc(-c2ncc(CN3C(=O)NC4(CCSC4)C3=O)s2)cc1 |
| InChI | InChI=1S/C19H21N3O2S2/c1-12(2)13-3-5-14(6-4-13)16-20-9-15(26-16)10-22-17(23)19(21-18(22)24)7-8-25-11-19/h3-6,9,12H,7-8,10-11H2,1-2H3,(H,21,24) |
| InChIKey | WRJVIPSPNZWPMC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|