About trimethyl-[(E,4S)-4-methyl-1-tributylstannyloct-1-en-4-yl]oxysilane
trimethyl-[(E,4S)-4-methyl-1-tributylstannyloct-1-en-4-yl]oxysilane (PubChem CID 12893764) has the molecular formula C24H52OSiSn
and a molecular weight of 503.48 g/mol. Its IUPAC name is trimethyl-[(E,4S)-4-methyl-1-tributylstannyloct-1-en-4-yl]oxysilane.
Molecular Properties
| Compound Name | trimethyl-[(E,4S)-4-methyl-1-tributylstannyloct-1-en-4-yl]oxysilane |
| PubChem CID | 12893764 |
| Molecular Formula | C24H52OSiSn |
| Molecular Weight | 503.48 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | trimethyl-[(E,4S)-4-methyl-1-tributylstannyloct-1-en-4-yl]oxysilane |
| SMILES | CCCC[C@@](C)(C/C=C/[Sn](CCCC)(CCCC)CCCC)O[Si](C)(C)C |
| InChI | InChI=1S/C12H25OSi.3C4H9.Sn/c1-7-9-11-12(3,10-8-2)13-14(4,5)6;3*1-3-4-2;/h2,8H,7,9-11H2,1,3-6H3;3*1,3-4H2,2H3;/t12-;;;;/m1..../s1 |
| InChIKey | QPDPSYPQQVBCLH-HHUWXINPSA-N |
| XLogP | 9.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 503.48 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(E,4S)-4-methyl-1-tributylstannyloct-1-en-4-yl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(E,4S)-4-methyl-1-tributylstannyloct-1-en-4-yl]oxysilane?
The IUPAC name of trimethyl-[(E,4S)-4-methyl-1-tributylstannyloct-1-en-4-yl]oxysilane (CID 12893764) is trimethyl-[(E,4S)-4-methyl-1-tributylstannyloct-1-en-4-yl]oxysilane.
What is the SMILES notation for trimethyl-[(E,4S)-4-methyl-1-tributylstannyloct-1-en-4-yl]oxysilane?
The canonical SMILES for trimethyl-[(E,4S)-4-methyl-1-tributylstannyloct-1-en-4-yl]oxysilane is CCCC[C@@](C)(C/C=C/[Sn](CCCC)(CCCC)CCCC)O[Si](C)(C)C.
What is the InChIKey of trimethyl-[(E,4S)-4-methyl-1-tributylstannyloct-1-en-4-yl]oxysilane?
The InChIKey is QPDPSYPQQVBCLH-HHUWXINPSA-N. The full InChI is InChI=1S/C12H25OSi.3C4H9.Sn/c1-7-9-11-12(3,10-8-2)13-14(4,5)6;3*1-3-4-2;/h2,8H,7,9-11H2,1,3-6H3;3*1,3-4H2,2H3;/t12-;;;;/m1..../s1.
What are the key properties of trimethyl-[(E,4S)-4-methyl-1-tributylstannyloct-1-en-4-yl]oxysilane?
trimethyl-[(E,4S)-4-methyl-1-tributylstannyloct-1-en-4-yl]oxysilane has a molecular weight of 503.48 g/mol, XLogP of 9.12, 17 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(E,4S)-4-methyl-1-tributylstannyloct-1-en-4-yl]oxysilane is sourced from PubChem (CID 12893764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).