C13H13NO — CID 12894956
2-(5,8-dihydronaphthalen-1-yloxy)propanenitrile (PubChem CID 12894956) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-(5,8-dihydronaphthalen-1-yloxy)propanenitrile.
| Compound Name | 2-(5,8-dihydronaphthalen-1-yloxy)propanenitrile |
|---|---|
| PubChem CID | 12894956 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 2-(5,8-dihydronaphthalen-1-yloxy)propanenitrile |
| SMILES | CC(C#N)Oc1cccc2c1CC=CC2 |
| InChI | InChI=1S/C13H13NO/c1-10(9-14)15-13-8-4-6-11-5-2-3-7-12(11)13/h2-4,6,8,10H,5,7H2,1H3 |
| InChIKey | FOVKZERZHNGGME-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|