C14H16N2O4 — CID 12895311
6-methoxy-2,2-dimethylspiro[3H-chromene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 12895311) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 6-methoxy-2,2-dimethylspiro[3H-chromene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | 6-methoxy-2,2-dimethylspiro[3H-chromene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 12895311 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 6-methoxy-2,2-dimethylspiro[3H-chromene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | COc1ccc2c(c1)C1(CC(C)(C)O2)NC(=O)NC1=O |
| InChI | InChI=1S/C14H16N2O4/c1-13(2)7-14(11(17)15-12(18)16-14)9-6-8(19-3)4-5-10(9)20-13/h4-6H,7H2,1-3H3,(H2,15,16,17,18) |
| InChIKey | WGVOQYCMTWNDPY-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|